About methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate
methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate (PubChem CID 72698497) has the molecular formula C11H10FNO2
and a molecular weight of 207.20 g/mol. Its IUPAC name is methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate |
| PubChem CID | 72698497 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate |
| SMILES | COC(=O)C1=C2C(F)=CC=CC2NC=C1 |
| InChI | InChI=1S/C11H10FNO2/c1-15-11(14)7-5-6-13-9-4-2-3-8(12)10(7)9/h2-6,9,13H,1H3 |
| InChIKey | JDLQGCNSOXMUGE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate?
The IUPAC name of methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate (CID 72698497) is methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate.
What is the SMILES notation for methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate?
The canonical SMILES for methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate is COC(=O)C1=C2C(F)=CC=CC2NC=C1.
What is the InChIKey of methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate?
The InChIKey is JDLQGCNSOXMUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2/c1-15-11(14)7-5-6-13-9-4-2-3-8(12)10(7)9/h2-6,9,13H,1H3.
What are the key properties of methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate?
methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate has a molecular weight of 207.20 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-fluoro-1,8a-dihydroquinoline-4-carboxylate is sourced from PubChem (CID 72698497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).