C15H11F2IO3 — CID 72698508
methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate (PubChem CID 72698508) has the molecular formula C15H11F2IO3 and a molecular weight of 404.15 g/mol. Its IUPAC name is methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate.
| Compound Name | methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate |
|---|---|
| PubChem CID | 72698508 |
| Molecular Formula | C15H11F2IO3 |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate |
| SMILES | COC(=O)c1cc(I)ccc1OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F2IO3/c1-20-15(19)11-7-10(18)3-5-14(11)21-8-9-2-4-12(16)13(17)6-9/h2-7H,8H2,1H3 |
| InChIKey | LZIVFJPGVOKPBL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|