methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate

C15H11F2IO3 — CID 72698508

IUPACmethyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate
SMILESCOC(=O)c1cc(I)ccc1OCc1ccc(F)c(F)c1
InChIInChI=1S/C15H11F2IO3/c1-20-15(19)11-7-10(18)3-5-14(11)21-8-9-2-4-12(16)13(17)6-9/h2-7H,8H2,1H3
InChIKeyLZIVFJPGVOKPBL-UHFFFAOYSA-N
MW404.15 g/mol
LogP3.93
Rot. Bonds4

About methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate

methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate (PubChem CID 72698508) has the molecular formula C15H11F2IO3 and a molecular weight of 404.15 g/mol. Its IUPAC name is methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate.

Molecular Properties

Compound Namemethyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate
PubChem CID72698508
Molecular FormulaC15H11F2IO3
Molecular Weight404.15 g/mol
Exact Mass403.97
IUPAC Namemethyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate
SMILESCOC(=O)c1cc(I)ccc1OCc1ccc(F)c(F)c1
InChIInChI=1S/C15H11F2IO3/c1-20-15(19)11-7-10(18)3-5-14(11)21-8-9-2-4-12(16)13(17)6-9/h2-7H,8H2,1H3
InChIKeyLZIVFJPGVOKPBL-UHFFFAOYSA-N
XLogP3.93
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500404.15
LogP ≤ 53.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate?
The IUPAC name of methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate (CID 72698508) is methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate.
What is the SMILES notation for methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate?
The canonical SMILES for methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate is COC(=O)c1cc(I)ccc1OCc1ccc(F)c(F)c1.
What is the InChIKey of methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate?
The InChIKey is LZIVFJPGVOKPBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2IO3/c1-20-15(19)11-7-10(18)3-5-14(11)21-8-9-2-4-12(16)13(17)6-9/h2-7H,8H2,1H3.
What are the key properties of methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate?
methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate has a molecular weight of 404.15 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,4-difluorophenyl)methoxy]-5-iodobenzoate is sourced from PubChem (CID 72698508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).