C29H44N6O9 — CID 72698608
(2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid (PubChem CID 72698608) has the molecular formula C29H44N6O9 and a molecular weight of 620.70 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 72698608 |
| Molecular Formula | C29H44N6O9 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[(2S)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)OCc1ccccc1)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C29H44N6O9/c1-5-17(4)24(27(40)34-23(16(2)3)28(41)42)35-26(39)19(11-13-21(30)36)32-25(38)20(12-14-22(31)37)33-29(43)44-15-18-9-7-6-8-10-18/h6-10,16-17,19-20,23-24H,5,11-15H2,1-4H3,(H2,30,36)(H2,31,37)(H,32,38)(H,33,43)(H,34,40)(H,35,39)(H,41,42)/t17?,19-,20-,23-,24-/m0/s1 |
| InChIKey | CEARYJVRLMOTPI-UJOSLUCCSA-N |
| XLogP | 0.05 |
| TPSA | 249.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |