About 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one
6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 72698788) has the molecular formula C10H8FNO
and a molecular weight of 177.18 g/mol. Its IUPAC name is 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 72698788 |
| Molecular Formula | C10H8FNO |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C12CC2 |
| InChI | InChI=1S/C10H8FNO/c11-6-1-2-7-8(5-6)12-9(13)10(7)3-4-10/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | MGSBFWIIFWQXSG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (CID 72698788) is 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one is O=C1Nc2cc(F)ccc2C12CC2.
What is the InChIKey of 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is MGSBFWIIFWQXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO/c11-6-1-2-7-8(5-6)12-9(13)10(7)3-4-10/h1-2,5H,3-4H2,(H,12,13).
What are the key properties of 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one?
6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 177.18 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 72698788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).