C40H52N10O2 — CID 72699193
N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]butanamide (PubChem CID 72699193) has the molecular formula C40H52N10O2 and a molecular weight of 704.92 g/mol. Its IUPAC name is N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]butanamide.
| Compound Name | N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]butanamide |
|---|---|
| PubChem CID | 72699193 |
| Molecular Formula | C40H52N10O2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.43 |
| IUPAC Name | N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenoxy]butanamide |
| SMILES | CN1CCN(c2ccc3nc(-c4ccc5nc(-c6cc(C(C)(C)C)c(OCCCC(=O)NCCCN=[N+]=[N-])c(C(C)(C)C)c6)[nH]c5c4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C40H52N10O2/c1-39(2,3)29-22-27(23-30(40(4,5)6)36(29)52-21-8-10-35(51)42-15-9-16-43-48-41)38-45-31-13-11-26(24-33(31)46-38)37-44-32-14-12-28(25-34(32)47-37)50-19-17-49(7)18-20-50/h11-14,22-25H,8-10,15-21H2,1-7H3,(H,42,51)(H,44,47)(H,45,46) |
| InChIKey | DBAVEZIQOUWRMX-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 150.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|