C9H9N3S — CID 726995
5-(2-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 726995) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 5-(2-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 726995 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 5-(2-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cc1ccccc1-c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C9H9N3S/c1-6-4-2-3-5-7(6)8-10-9(13)12-11-8/h2-5H,1H3,(H2,10,11,12,13) |
| InChIKey | SMHIAXYYNWVQCY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|