C16H19NO2 — CID 72699600
3-tert-butyl-1,3,4,5-tetrahydropyrano[4,3-c]isoquinolin-6-one (PubChem CID 72699600) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-tert-butyl-1,3,4,5-tetrahydropyrano[4,3-c]isoquinolin-6-one.
| Compound Name | 3-tert-butyl-1,3,4,5-tetrahydropyrano[4,3-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 72699600 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-tert-butyl-1,3,4,5-tetrahydropyrano[4,3-c]isoquinolin-6-one |
| SMILES | CC(C)(C)C1Cc2[nH]c(=O)c3ccccc3c2CO1 |
| InChI | InChI=1S/C16H19NO2/c1-16(2,3)14-8-13-12(9-19-14)10-6-4-5-7-11(10)15(18)17-13/h4-7,14H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | FDRSTRFXLSPIHO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |