C21H16F6N4O — CID 72699710
1,1,1,3,3,3-hexafluoro-2-[4-[[5-(5-methyl-1H-1,2,4-triazol-3-yl)indol-1-yl]methyl]phenyl]propan-2-ol (PubChem CID 72699710) has the molecular formula C21H16F6N4O and a molecular weight of 454.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[[5-(5-methyl-1H-1,2,4-triazol-3-yl)indol-1-yl]methyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[[5-(5-methyl-1H-1,2,4-triazol-3-yl)indol-1-yl]methyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 72699710 |
| Molecular Formula | C21H16F6N4O |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[[5-(5-methyl-1H-1,2,4-triazol-3-yl)indol-1-yl]methyl]phenyl]propan-2-ol |
| SMILES | Cc1nc(-c2ccc3c(ccn3Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c2)n[nH]1 |
| InChI | InChI=1S/C21H16F6N4O/c1-12-28-18(30-29-12)15-4-7-17-14(10-15)8-9-31(17)11-13-2-5-16(6-3-13)19(32,20(22,23)24)21(25,26)27/h2-10,32H,11H2,1H3,(H,28,29,30) |
| InChIKey | GJUIZCZNDAXKFI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |