C21H27NO2S — CID 72699717
(1S)-5-methoxy-14-pentyl-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol (PubChem CID 72699717) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is (1S)-5-methoxy-14-pentyl-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol.
| Compound Name | (1S)-5-methoxy-14-pentyl-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol |
|---|---|
| PubChem CID | 72699717 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (1S)-5-methoxy-14-pentyl-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol |
| SMILES | CCCCCc1cc2c(s1)C[C@H]1c3cc(O)c(OC)cc3CCN1C2 |
| InChI | InChI=1S/C21H27NO2S/c1-3-4-5-6-16-9-15-13-22-8-7-14-10-20(24-2)19(23)11-17(14)18(22)12-21(15)25-16/h9-11,18,23H,3-8,12-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | PLCWEVBEXIVMCL-SFHVURJKSA-N |
| XLogP | 4.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|