C21H25NO2S — CID 72699718
(1S)-14-(cyclobutylmethyl)-5-methoxy-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol (PubChem CID 72699718) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is (1S)-14-(cyclobutylmethyl)-5-methoxy-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol.
| Compound Name | (1S)-14-(cyclobutylmethyl)-5-methoxy-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol |
|---|---|
| PubChem CID | 72699718 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (1S)-14-(cyclobutylmethyl)-5-methoxy-15-thia-10-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,12(16),13-pentaen-4-ol |
| SMILES | COc1cc2c(cc1O)[C@@H]1Cc3sc(CC4CCC4)cc3CN1CC2 |
| InChI | InChI=1S/C21H25NO2S/c1-24-20-9-14-5-6-22-12-15-8-16(7-13-3-2-4-13)25-21(15)11-18(22)17(14)10-19(20)23/h8-10,13,18,23H,2-7,11-12H2,1H3/t18-/m0/s1 |
| InChIKey | ALDCLQHVTZPMQV-SFHVURJKSA-N |
| XLogP | 4.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |