C10H19NO3 — CID 72699790
(1R,2R,3R,6S)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol (PubChem CID 72699790) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (1R,2R,3R,6S)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2R,3R,6S)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 72699790 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (1R,2R,3R,6S)-6-(2-methylpropylamino)cyclohex-4-ene-1,2,3-triol |
| SMILES | CC(C)CN[C@H]1C=C[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H19NO3/c1-6(2)5-11-7-3-4-8(12)10(14)9(7)13/h3-4,6-14H,5H2,1-2H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | SDOUZJGXMWXJFF-SGIHWFKDSA-N |
| XLogP | -0.75 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|