C20H15F6N3O2 — CID 72699897
1,1,1,3,3,3-hexafluoro-2-[4-[[5-(1,2,5-oxadiazol-3-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]propan-2-ol (PubChem CID 72699897) has the molecular formula C20H15F6N3O2 and a molecular weight of 443.35 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[[5-(1,2,5-oxadiazol-3-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[[5-(1,2,5-oxadiazol-3-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 72699897 |
| Molecular Formula | C20H15F6N3O2 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[[5-(1,2,5-oxadiazol-3-yl)-2,3-dihydroindol-1-yl]methyl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(CN2CCc3cc(-c4cnon4)ccc32)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H15F6N3O2/c21-19(22,23)18(30,20(24,25)26)15-4-1-12(2-5-15)11-29-8-7-14-9-13(3-6-17(14)29)16-10-27-31-28-16/h1-6,9-10,30H,7-8,11H2 |
| InChIKey | HWWLLSHOHYLEQY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |