C28H28N4O — CID 72700752
4-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 72700752) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 72700752 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4-[4-(2-piperidin-1-ylethoxy)phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(-c2cc(-c3ccc(OCCN4CCCCC4)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C28H28N4O/c1-6-16-32(17-7-1)18-19-33-24-12-10-22(11-13-24)23-20-27(25-8-2-4-14-29-25)31-28(21-23)26-9-3-5-15-30-26/h2-5,8-15,20-21H,1,6-7,16-19H2 |
| InChIKey | BOLQQQXIABPZEU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |