C21H38O3Si — CID 72701081
(1S,2S,3S,6E,10R)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-6,10-dimethyl-11-oxabicyclo[8.1.0]undec-6-en-2-ol (PubChem CID 72701081) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (1S,2S,3S,6E,10R)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-6,10-dimethyl-11-oxabicyclo[8.1.0]undec-6-en-2-ol.
| Compound Name | (1S,2S,3S,6E,10R)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-6,10-dimethyl-11-oxabicyclo[8.1.0]undec-6-en-2-ol |
|---|---|
| PubChem CID | 72701081 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (1S,2S,3S,6E,10R)-3-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-6,10-dimethyl-11-oxabicyclo[8.1.0]undec-6-en-2-ol |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)[C@@H]1CC/C(C)=C/CC[C@@]2(C)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C21H38O3Si/c1-15-10-9-13-21(6)19(24-21)18(22)17(12-11-15)16(2)14-23-25(7,8)20(3,4)5/h10,17-19,22H,2,9,11-14H2,1,3-8H3/b15-10+/t17-,18-,19-,21+/m0/s1 |
| InChIKey | VCEWCWIARKDAMN-WFBRUREMSA-N |
| XLogP | 5.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|