About ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate
ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate (PubChem CID 72701269) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate |
| PubChem CID | 72701269 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(=O)CCN2C1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H21N3O3/c1-4-23-17(22)14-11-20-15(21)9-10-19(20)16(14)12-5-7-13(8-6-12)18(2)3/h5-8,11,16H,4,9-10H2,1-3H3 |
| InChIKey | AUSORXNGKNHERD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate?
The IUPAC name of ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate (CID 72701269) is ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate.
What is the SMILES notation for ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate?
The canonical SMILES for ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate is CCOC(=O)C1=CN2C(=O)CCN2C1c1ccc(N(C)C)cc1.
What is the InChIKey of ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate?
The InChIKey is AUSORXNGKNHERD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-4-23-17(22)14-11-20-15(21)9-10-19(20)16(14)12-5-7-13(8-6-12)18(2)3/h5-8,11,16H,4,9-10H2,1-3H3.
What are the key properties of ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate?
ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate has a molecular weight of 315.37 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[4-(dimethylamino)phenyl]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate is sourced from PubChem (CID 72701269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).