C16H26O3S — CID 72701360
S-tert-butyl (E,8R)-4,8-dimethyl-3,10-dioxodec-4-enethioate (PubChem CID 72701360) has the molecular formula C16H26O3S and a molecular weight of 298.45 g/mol. Its IUPAC name is S-tert-butyl (E,8R)-4,8-dimethyl-3,10-dioxodec-4-enethioate.
| Compound Name | S-tert-butyl (E,8R)-4,8-dimethyl-3,10-dioxodec-4-enethioate |
|---|---|
| PubChem CID | 72701360 |
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | S-tert-butyl (E,8R)-4,8-dimethyl-3,10-dioxodec-4-enethioate |
| SMILES | C/C(=C\CC[C@@H](C)CC=O)C(=O)CC(=O)SC(C)(C)C |
| InChI | InChI=1S/C16H26O3S/c1-12(9-10-17)7-6-8-13(2)14(18)11-15(19)20-16(3,4)5/h8,10,12H,6-7,9,11H2,1-5H3/b13-8+/t12-/m1/s1 |
| InChIKey | CYERDBARKCMUBE-FMNNIJNLSA-N |
| XLogP | 3.96 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|