C27H33N3O5Si — CID 72701396
[(3S,4S,5S)-4-acetyloxy-5-azido-3-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]methyl acetate (PubChem CID 72701396) has the molecular formula C27H33N3O5Si and a molecular weight of 507.66 g/mol. Its IUPAC name is [(3S,4S,5S)-4-acetyloxy-5-azido-3-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S,5S)-4-acetyloxy-5-azido-3-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 72701396 |
| Molecular Formula | C27H33N3O5Si |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | [(3S,4S,5S)-4-acetyloxy-5-azido-3-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC(C)=O)[C@@H](N=[N+]=[N-])C1 |
| InChI | InChI=1S/C27H33N3O5Si/c1-19(31)33-18-21-16-24(29-30-28)26(34-20(2)32)25(17-21)35-36(27(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,17,24-26H,16,18H2,1-5H3/t24-,25-,26-/m0/s1 |
| InChIKey | VITWXXQLZZPWOL-GSDHBNRESA-N |
| XLogP | 4.44 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|