C36H42O17S — CID 72701409
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 72701409) has the molecular formula C36H42O17S and a molecular weight of 778.78 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 72701409 |
| Molecular Formula | C36H42O17S |
| Molecular Weight | 778.78 g/mol |
| Exact Mass | 778.21 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-naphthalen-2-ylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](Sc3ccc4ccccc4c3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C36H42O17S/c1-17(37)44-15-27-29(46-18(2)38)31(48-20(4)40)33(50-22(6)42)35(52-27)45-16-28-30(47-19(3)39)32(49-21(5)41)34(51-23(7)43)36(53-28)54-26-13-12-24-10-8-9-11-25(24)14-26/h8-14,27-36H,15-16H2,1-7H3/t27-,28-,29+,30-,31+,32+,33-,34-,35-,36+/m1/s1 |
| InChIKey | AEWBMQFUHXOFGT-XGGIYNTRSA-N |
| XLogP | 2.55 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|