C24H23O3P — CID 72701570
1-ethoxy-7,8-dimethyl-3,4-diphenyl-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 72701570) has the molecular formula C24H23O3P and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-ethoxy-7,8-dimethyl-3,4-diphenyl-2,1λ5-benzoxaphosphinine 1-oxide.
| Compound Name | 1-ethoxy-7,8-dimethyl-3,4-diphenyl-2,1λ5-benzoxaphosphinine 1-oxide |
|---|---|
| PubChem CID | 72701570 |
| Molecular Formula | C24H23O3P |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-ethoxy-7,8-dimethyl-3,4-diphenyl-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCOP1(=O)OC(c2ccccc2)=C(c2ccccc2)c2ccc(C)c(C)c21 |
| InChI | InChI=1S/C24H23O3P/c1-4-26-28(25)24-18(3)17(2)15-16-21(24)22(19-11-7-5-8-12-19)23(27-28)20-13-9-6-10-14-20/h5-16H,4H2,1-3H3 |
| InChIKey | VIORHDCIZKHVLH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|