About CID 72701773
CID 72701773 (PubChem CID 72701773) has the molecular formula C23H21BrFeN4O+2
and a molecular weight of 505.20 g/mol.
Molecular Properties
| Compound Name | CID 72701773 |
| PubChem CID | 72701773 |
| Molecular Formula | C23H21BrFeN4O+2 |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | — |
| SMILES | Cn1ncc(N(Cc2ccccc2)/N=C/[C]2[CH][CH][CH][CH]2)c(Br)c1=O.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C18H16BrN4O.C5H5.Fe/c1-22-18(24)17(19)16(12-20-22)23(13-15-9-3-2-4-10-15)21-11-14-7-5-6-8-14;1-2-4-5-3-1;/h2-12H,13H2,1H3;1-5H;/q;;+2/b21-11+;; |
| InChIKey | MEBHLTUCOOJLBI-JVCHBHOBSA-N |
| XLogP | 3.96 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 72701773 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72701773?
The IUPAC name of CID 72701773 (CID 72701773) is not available.
What is the SMILES notation for CID 72701773?
The canonical SMILES for CID 72701773 is Cn1ncc(N(Cc2ccccc2)/N=C/[C]2[CH][CH][CH][CH]2)c(Br)c1=O.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 72701773?
The InChIKey is MEBHLTUCOOJLBI-JVCHBHOBSA-N. The full InChI is InChI=1S/C18H16BrN4O.C5H5.Fe/c1-22-18(24)17(19)16(12-20-22)23(13-15-9-3-2-4-10-15)21-11-14-7-5-6-8-14;1-2-4-5-3-1;/h2-12H,13H2,1H3;1-5H;/q;;+2/b21-11+;;.
What are the key properties of CID 72701773?
CID 72701773 has a molecular weight of 505.20 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72701773 is sourced from PubChem (CID 72701773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).