C24H48O3Si2 — CID 72701905
(2E,4E,6S,7R,8S,9S)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-9-triethylsilyloxydeca-2,4-dienal (PubChem CID 72701905) has the molecular formula C24H48O3Si2 and a molecular weight of 440.82 g/mol. Its IUPAC name is (2E,4E,6S,7R,8S,9S)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-9-triethylsilyloxydeca-2,4-dienal.
| Compound Name | (2E,4E,6S,7R,8S,9S)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-9-triethylsilyloxydeca-2,4-dienal |
|---|---|
| PubChem CID | 72701905 |
| Molecular Formula | C24H48O3Si2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (2E,4E,6S,7R,8S,9S)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-9-triethylsilyloxydeca-2,4-dienal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C=C/C=O |
| InChI | InChI=1S/C24H48O3Si2/c1-12-29(13-2,14-3)26-22(6)21(5)23(20(4)18-16-15-17-19-25)27-28(10,11)24(7,8)9/h15-23H,12-14H2,1-11H3/b17-15+,18-16+/t20-,21-,22-,23+/m0/s1 |
| InChIKey | GUWVYAZWORNYKN-AKYRXYQASA-N |
| XLogP | 7.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|