C23H34O3 — CID 72702445
(1S,2R,5S,7S,10R,11S,14R,15R)-16-ethenyl-10,14-dimethyl-18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icos-16-ene-5,7-diol (PubChem CID 72702445) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (1S,2R,5S,7S,10R,11S,14R,15R)-16-ethenyl-10,14-dimethyl-18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icos-16-ene-5,7-diol.
| Compound Name | (1S,2R,5S,7S,10R,11S,14R,15R)-16-ethenyl-10,14-dimethyl-18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icos-16-ene-5,7-diol |
|---|---|
| PubChem CID | 72702445 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (1S,2R,5S,7S,10R,11S,14R,15R)-16-ethenyl-10,14-dimethyl-18-oxapentacyclo[13.3.2.01,14.02,11.05,10]icos-16-ene-5,7-diol |
| SMILES | C=CC1=CO[C@]23CC[C@H]1[C@@]2(C)CC[C@H]1[C@H]3CC[C@]2(O)C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C23H34O3/c1-4-15-14-26-23-12-8-17(15)21(23,3)10-6-18-19(23)7-11-22(25)13-16(24)5-9-20(18,22)2/h4,14,16-19,24-25H,1,5-13H2,2-3H3/t16-,17+,18-,19+,20+,21+,22-,23-/m0/s1 |
| InChIKey | KIRLHPHUEPKCDT-PSYBGMFNSA-N |
| XLogP | 4.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |