C27H18FNO4 — CID 72702669
3-benzoyl-2-ethoxy-1-(4-fluorophenyl)benzo[f]indole-4,9-dione (PubChem CID 72702669) has the molecular formula C27H18FNO4 and a molecular weight of 439.44 g/mol. Its IUPAC name is 3-benzoyl-2-ethoxy-1-(4-fluorophenyl)benzo[f]indole-4,9-dione.
| Compound Name | 3-benzoyl-2-ethoxy-1-(4-fluorophenyl)benzo[f]indole-4,9-dione |
|---|---|
| PubChem CID | 72702669 |
| Molecular Formula | C27H18FNO4 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-benzoyl-2-ethoxy-1-(4-fluorophenyl)benzo[f]indole-4,9-dione |
| SMILES | CCOc1c(C(=O)c2ccccc2)c2c(n1-c1ccc(F)cc1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H18FNO4/c1-2-33-27-22(24(30)16-8-4-3-5-9-16)21-23(29(27)18-14-12-17(28)13-15-18)26(32)20-11-7-6-10-19(20)25(21)31/h3-15H,2H2,1H3 |
| InChIKey | GFOSTNYCXHKCTO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|