C35H36F3N3O — CID 72702742
3-N',3-N',6-N',6-N'-tetraethyl-2-[4-(trifluoromethyl)phenyl]spiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine (PubChem CID 72702742) has the molecular formula C35H36F3N3O and a molecular weight of 571.69 g/mol. Its IUPAC name is 3-N',3-N',6-N',6-N'-tetraethyl-2-[4-(trifluoromethyl)phenyl]spiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine.
| Compound Name | 3-N',3-N',6-N',6-N'-tetraethyl-2-[4-(trifluoromethyl)phenyl]spiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine |
|---|---|
| PubChem CID | 72702742 |
| Molecular Formula | C35H36F3N3O |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 3-N',3-N',6-N',6-N'-tetraethyl-2-[4-(trifluoromethyl)phenyl]spiro[1H-isoindole-3,9'-xanthene]-3',6'-diamine |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C21c2ccccc2CN1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H36F3N3O/c1-5-39(6-2)27-17-19-30-32(21-27)42-33-22-28(40(7-3)8-4)18-20-31(33)34(30)29-12-10-9-11-24(29)23-41(34)26-15-13-25(14-16-26)35(36,37)38/h9-22H,5-8,23H2,1-4H3 |
| InChIKey | YETFUFPASCNJEY-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|