C16H27NO3SSi — CID 72702802
(NE)-N-[[(4aS,5R)-5-trimethylsilyloxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]methylidene]methanesulfonamide (PubChem CID 72702802) has the molecular formula C16H27NO3SSi and a molecular weight of 341.55 g/mol. Its IUPAC name is (NE)-N-[[(4aS,5R)-5-trimethylsilyloxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]methylidene]methanesulfonamide.
| Compound Name | (NE)-N-[[(4aS,5R)-5-trimethylsilyloxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]methylidene]methanesulfonamide |
|---|---|
| PubChem CID | 72702802 |
| Molecular Formula | C16H27NO3SSi |
| Molecular Weight | 341.55 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (NE)-N-[[(4aS,5R)-5-trimethylsilyloxy-2,3,4,4a,5,8-hexahydro-1H-benzo[7]annulen-9-yl]methylidene]methanesulfonamide |
| SMILES | C[Si](C)(C)O[C@@H]1C=CCC(/C=N/S(C)(=O)=O)=C2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H27NO3SSi/c1-21(18,19)17-12-13-8-7-11-16(20-22(2,3)4)15-10-6-5-9-14(13)15/h7,11-12,15-16H,5-6,8-10H2,1-4H3/b17-12+/t15-,16+/m0/s1 |
| InChIKey | XRDSGKLTXGRZSM-IGPFEKLESA-N |
| XLogP | 3.68 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|