C26H36N4O8S — CID 72702887
tert-butyl (E,3R,5S)-3,5-dihydroxy-7-[2-[methyl(methylsulfonyl)amino]-4-(4-nitrophenyl)-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate (PubChem CID 72702887) has the molecular formula C26H36N4O8S and a molecular weight of 564.66 g/mol. Its IUPAC name is tert-butyl (E,3R,5S)-3,5-dihydroxy-7-[2-[methyl(methylsulfonyl)amino]-4-(4-nitrophenyl)-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate.
| Compound Name | tert-butyl (E,3R,5S)-3,5-dihydroxy-7-[2-[methyl(methylsulfonyl)amino]-4-(4-nitrophenyl)-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate |
|---|---|
| PubChem CID | 72702887 |
| Molecular Formula | C26H36N4O8S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | tert-butyl (E,3R,5S)-3,5-dihydroxy-7-[2-[methyl(methylsulfonyl)amino]-4-(4-nitrophenyl)-6-propan-2-ylpyrimidin-5-yl]hept-6-enoate |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc([N+](=O)[O-])cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H36N4O8S/c1-16(2)23-21(13-12-19(31)14-20(32)15-22(33)38-26(3,4)5)24(17-8-10-18(11-9-17)30(34)35)28-25(27-23)29(6)39(7,36)37/h8-13,16,19-20,31-32H,14-15H2,1-7H3/b13-12+/t19-,20-/m1/s1 |
| InChIKey | JDMANRUVDDBWSY-OKLSWEBGSA-N |
| XLogP | 3.43 |
| TPSA | 173.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|