About 7-bromo-2-fluorodibenzothiophene 5,5-dioxide
7-bromo-2-fluorodibenzothiophene 5,5-dioxide (PubChem CID 72703254) has the molecular formula C12H6BrFO2S
and a molecular weight of 313.15 g/mol. Its IUPAC name is 7-bromo-2-fluorodibenzothiophene 5,5-dioxide.
Molecular Properties
| Compound Name | 7-bromo-2-fluorodibenzothiophene 5,5-dioxide |
| PubChem CID | 72703254 |
| Molecular Formula | C12H6BrFO2S |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | 7-bromo-2-fluorodibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccc(F)cc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C12H6BrFO2S/c13-7-1-3-9-10-6-8(14)2-4-11(10)17(15,16)12(9)5-7/h1-6H |
| InChIKey | TVILWUZIHPGQEX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-fluorodibenzothiophene 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-fluorodibenzothiophene 5,5-dioxide?
The IUPAC name of 7-bromo-2-fluorodibenzothiophene 5,5-dioxide (CID 72703254) is 7-bromo-2-fluorodibenzothiophene 5,5-dioxide.
What is the SMILES notation for 7-bromo-2-fluorodibenzothiophene 5,5-dioxide?
The canonical SMILES for 7-bromo-2-fluorodibenzothiophene 5,5-dioxide is O=S1(=O)c2ccc(F)cc2-c2ccc(Br)cc21.
What is the InChIKey of 7-bromo-2-fluorodibenzothiophene 5,5-dioxide?
The InChIKey is TVILWUZIHPGQEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrFO2S/c13-7-1-3-9-10-6-8(14)2-4-11(10)17(15,16)12(9)5-7/h1-6H.
What are the key properties of 7-bromo-2-fluorodibenzothiophene 5,5-dioxide?
7-bromo-2-fluorodibenzothiophene 5,5-dioxide has a molecular weight of 313.15 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-fluorodibenzothiophene 5,5-dioxide is sourced from PubChem (CID 72703254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).