C29H32F6N2O3 — CID 72703276
5-[[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-propan-2-ylcyclopentyl]amino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 72703276) has the molecular formula C29H32F6N2O3 and a molecular weight of 570.57 g/mol. Its IUPAC name is 5-[[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-propan-2-ylcyclopentyl]amino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 5-[[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-propan-2-ylcyclopentyl]amino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 72703276 |
| Molecular Formula | C29H32F6N2O3 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 5-[[(1R,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-3-propan-2-ylcyclopentyl]amino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | CC(C)[C@]1(C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC[C@@H](NC2CCCc3c(C(=O)O)cccc32)C1 |
| InChI | InChI=1S/C29H32F6N2O3/c1-16(2)27(26(40)36-15-17-11-18(28(30,31)32)13-19(12-17)29(33,34)35)10-9-20(14-27)37-24-8-4-5-21-22(24)6-3-7-23(21)25(38)39/h3,6-7,11-13,16,20,24,37H,4-5,8-10,14-15H2,1-2H3,(H,36,40)(H,38,39)/t20-,24?,27+/m1/s1 |
| InChIKey | XDYWGCMFTWIWPD-SQEVJZLMSA-N |
| XLogP | 6.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |