About (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one
(3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one (PubChem CID 72703463) has the molecular formula C16H15NO3
and a molecular weight of 269.30 g/mol. Its IUPAC name is (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one |
| PubChem CID | 72703463 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one |
| SMILES | CO[C@@H]1C(=O)Nc2ccccc2[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c1-20-14-15(18)17-13-10-6-5-9-12(13)16(14,19)11-7-3-2-4-8-11/h2-10,14,19H,1H3,(H,17,18)/t14-,16+/m1/s1 |
| InChIKey | ZJKJPVOOYVJWFU-ZBFHGGJFSA-N |
| XLogP | 1.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one?
The IUPAC name of (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one (CID 72703463) is (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one.
What is the SMILES notation for (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one?
The canonical SMILES for (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one is CO[C@@H]1C(=O)Nc2ccccc2[C@@]1(O)c1ccccc1.
What is the InChIKey of (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one?
The InChIKey is ZJKJPVOOYVJWFU-ZBFHGGJFSA-N. The full InChI is InChI=1S/C16H15NO3/c1-20-14-15(18)17-13-10-6-5-9-12(13)16(14,19)11-7-3-2-4-8-11/h2-10,14,19H,1H3,(H,17,18)/t14-,16+/m1/s1.
What are the key properties of (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one?
(3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one has a molecular weight of 269.30 g/mol, XLogP of 1.89, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-hydroxy-3-methoxy-4-phenyl-1,3-dihydroquinolin-2-one is sourced from PubChem (CID 72703463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).