C26H25F5N6O5 — CID 72703671
(1R,3S,5R)-2-[2-[3-acetyl-5-(pyrimidin-2-ylmethoxy)indazol-1-yl]acetyl]-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 72703671) has the molecular formula C26H25F5N6O5 and a molecular weight of 596.51 g/mol. Its IUPAC name is (1R,3S,5R)-2-[2-[3-acetyl-5-(pyrimidin-2-ylmethoxy)indazol-1-yl]acetyl]-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-2-[2-[3-acetyl-5-(pyrimidin-2-ylmethoxy)indazol-1-yl]acetyl]-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 72703671 |
| Molecular Formula | C26H25F5N6O5 |
| Molecular Weight | 596.51 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | (1R,3S,5R)-2-[2-[3-acetyl-5-(pyrimidin-2-ylmethoxy)indazol-1-yl]acetyl]-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CC(=O)c1nn(CC(=O)N2[C@@H]3C[C@@H]3C[C@H]2C(=O)NCCOC(F)(F)C(F)(F)F)c2ccc(OCc3ncccn3)cc12 |
| InChI | InChI=1S/C26H25F5N6O5/c1-14(38)23-17-11-16(41-13-21-32-5-2-6-33-21)3-4-18(17)36(35-23)12-22(39)37-19-9-15(19)10-20(37)24(40)34-7-8-42-26(30,31)25(27,28)29/h2-6,11,15,19-20H,7-10,12-13H2,1H3,(H,34,40)/t15-,19-,20+/m1/s1 |
| InChIKey | DXMDXMRBAYXROU-YSGRDPCXSA-N |
| XLogP | 2.89 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|