About N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide
N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide (PubChem CID 72703726) has the molecular formula C17H17FN6O2S
and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide |
| PubChem CID | 72703726 |
| Molecular Formula | C17H17FN6O2S |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide |
| SMILES | Nc1ncnc2ccc(-c3cc(F)cc(NS(=O)(=O)N4CCCC4)c3)nc12 |
| InChI | InChI=1S/C17H17FN6O2S/c18-12-7-11(14-3-4-15-16(22-14)17(19)21-10-20-15)8-13(9-12)23-27(25,26)24-5-1-2-6-24/h3-4,7-10,23H,1-2,5-6H2,(H2,19,20,21) |
| InChIKey | SULWOBWTWKYJPL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide?
The IUPAC name of N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide (CID 72703726) is N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide.
What is the SMILES notation for N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide?
The canonical SMILES for N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide is Nc1ncnc2ccc(-c3cc(F)cc(NS(=O)(=O)N4CCCC4)c3)nc12.
What is the InChIKey of N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide?
The InChIKey is SULWOBWTWKYJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN6O2S/c18-12-7-11(14-3-4-15-16(22-14)17(19)21-10-20-15)8-13(9-12)23-27(25,26)24-5-1-2-6-24/h3-4,7-10,23H,1-2,5-6H2,(H2,19,20,21).
What are the key properties of N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide?
N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide has a molecular weight of 388.43 g/mol, XLogP of 2.17, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluorophenyl]pyrrolidine-1-sulfonamide is sourced from PubChem (CID 72703726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).