C23H27ClN6O2 — CID 72704003
piperazin-1-ylmethyl 3-chloro-10-(2-cyclopropylethylamino)-4-methylpyrido[3,2-b][1,5]naphthyridine-6-carboxylate (PubChem CID 72704003) has the molecular formula C23H27ClN6O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is piperazin-1-ylmethyl 3-chloro-10-(2-cyclopropylethylamino)-4-methylpyrido[3,2-b][1,5]naphthyridine-6-carboxylate.
| Compound Name | piperazin-1-ylmethyl 3-chloro-10-(2-cyclopropylethylamino)-4-methylpyrido[3,2-b][1,5]naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 72704003 |
| Molecular Formula | C23H27ClN6O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | piperazin-1-ylmethyl 3-chloro-10-(2-cyclopropylethylamino)-4-methylpyrido[3,2-b][1,5]naphthyridine-6-carboxylate |
| SMILES | Cc1c(Cl)cnc2c(NCCC3CC3)c3nccc(C(=O)OCN4CCNCC4)c3nc12 |
| InChI | InChI=1S/C23H27ClN6O2/c1-14-17(24)12-28-20-18(14)29-19-16(23(31)32-13-30-10-8-25-9-11-30)5-7-27-21(19)22(20)26-6-4-15-2-3-15/h5,7,12,15,25H,2-4,6,8-11,13H2,1H3,(H,26,29) |
| InChIKey | YHMRJOULRAORFK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|