About [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride
[(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride (PubChem CID 72704308) has the molecular formula C20H34ClNO2
and a molecular weight of 355.95 g/mol. Its IUPAC name is [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride |
| PubChem CID | 72704308 |
| Molecular Formula | C20H34ClNO2 |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride |
| SMILES | CCCCCCCCc1ccc(CO[C@@H]2CN[C@@H](CO)C2)cc1.Cl |
| InChI | InChI=1S/C20H33NO2.ClH/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)16-23-20-13-19(15-22)21-14-20;/h9-12,19-22H,2-8,13-16H2,1H3;1H/t19-,20+;/m1./s1 |
| InChIKey | ICGWLOCGXMULOL-FDOHDBATSA-N |
| XLogP | 4.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
The IUPAC name of [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride (CID 72704308) is [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride.
What is the SMILES notation for [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
The canonical SMILES for [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride is CCCCCCCCc1ccc(CO[C@@H]2CN[C@@H](CO)C2)cc1.Cl.
What is the InChIKey of [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
The InChIKey is ICGWLOCGXMULOL-FDOHDBATSA-N. The full InChI is InChI=1S/C20H33NO2.ClH/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)16-23-20-13-19(15-22)21-14-20;/h9-12,19-22H,2-8,13-16H2,1H3;1H/t19-,20+;/m1./s1.
What are the key properties of [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride?
[(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride has a molecular weight of 355.95 g/mol, XLogP of 4.25, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-[(4-octylphenyl)methoxy]pyrrolidin-2-yl]methanol;hydrochloride is sourced from PubChem (CID 72704308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).