C17H22N8 — CID 72704320
2-[(E)-2-(2-ethyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 72704320) has the molecular formula C17H22N8 and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-[(E)-2-(2-ethyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[(E)-2-(2-ethyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 72704320 |
| Molecular Formula | C17H22N8 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-[(E)-2-(2-ethyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCn1nc(N2CCCC2)nc1/C=C/c1nc2nc(C)cc(C)n2n1 |
| InChI | InChI=1S/C17H22N8/c1-4-24-15(20-17(22-24)23-9-5-6-10-23)8-7-14-19-16-18-12(2)11-13(3)25(16)21-14/h7-8,11H,4-6,9-10H2,1-3H3/b8-7+ |
| InChIKey | SORCAMPMGWCYHG-BQYQJAHWSA-N |
| XLogP | 2.12 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |