C21H26F3N3O2 — CID 72704467
US9000182, 11, isomer 1 (PubChem CID 72704467) has the molecular formula C21H26F3N3O2 and a molecular weight of 409.45 g/mol.
| Compound Name | US9000182, 11, isomer 1 |
|---|---|
| PubChem CID | 72704467 |
| Molecular Formula | C21H26F3N3O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(OCCC(F)(F)F)cc1[C@@]21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C21H26F3N3O2/c1-13-18(25)27-21(26-13)17-11-16(29-10-9-20(22,23)24)4-3-14(17)12-19(21)7-5-15(28-2)6-8-19/h3-4,11,15H,5-10,12H2,1-2H3,(H2,25,27)/t15?,19?,21-/m0/s1 |
| InChIKey | JJEORDNWHQBLEW-ZJKHUDDUSA-N |
| XLogP | 4.13 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |