C15H20N8 — CID 72704534
2-[2-[5-(azetidin-1-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 72704534) has the molecular formula C15H20N8 and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-[2-[5-(azetidin-1-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[2-[5-(azetidin-1-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 72704534 |
| Molecular Formula | C15H20N8 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[2-[5-(azetidin-1-yl)-2-methyl-1,2,4-triazol-3-yl]ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2nc(CCc3nc(N4CCC4)nn3C)nc2n1 |
| InChI | InChI=1S/C15H20N8/c1-10-9-11(2)23-14(16-10)17-12(19-23)5-6-13-18-15(20-21(13)3)22-7-4-8-22/h9H,4-8H2,1-3H3 |
| InChIKey | VFIQPKCVWFPEFF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |