C17H21F3N8 — CID 72704535
5,7-dimethyl-2-[2-[5-pyrrolidin-1-yl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 72704535) has the molecular formula C17H21F3N8 and a molecular weight of 394.41 g/mol. Its IUPAC name is 5,7-dimethyl-2-[2-[5-pyrrolidin-1-yl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dimethyl-2-[2-[5-pyrrolidin-1-yl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 72704535 |
| Molecular Formula | C17H21F3N8 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5,7-dimethyl-2-[2-[5-pyrrolidin-1-yl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2nc(CCc3nc(N4CCCC4)nn3CC(F)(F)F)nc2n1 |
| InChI | InChI=1S/C17H21F3N8/c1-11-9-12(2)28-15(21-11)22-13(24-28)5-6-14-23-16(26-7-3-4-8-26)25-27(14)10-17(18,19)20/h9H,3-8,10H2,1-2H3 |
| InChIKey | YRKKSQGTYKJALL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |