C22H34O5 — CID 72704672
(1R,3aR,5S,7R,9aS)-5-hydroxy-1-(2-hydroxy-6-methylhept-5-en-2-yl)-7-methoxy-3a-methyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[b]chromen-8-one (PubChem CID 72704672) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (1R,3aR,5S,7R,9aS)-5-hydroxy-1-(2-hydroxy-6-methylhept-5-en-2-yl)-7-methoxy-3a-methyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[b]chromen-8-one.
| Compound Name | (1R,3aR,5S,7R,9aS)-5-hydroxy-1-(2-hydroxy-6-methylhept-5-en-2-yl)-7-methoxy-3a-methyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[b]chromen-8-one |
|---|---|
| PubChem CID | 72704672 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1R,3aR,5S,7R,9aS)-5-hydroxy-1-(2-hydroxy-6-methylhept-5-en-2-yl)-7-methoxy-3a-methyl-1,2,3,5,6,7,9,9a-octahydrocyclopenta[b]chromen-8-one |
| SMILES | CO[C@@H]1C[C@H](O)C2=C(C[C@H]3[C@H](C(C)(O)CCC=C(C)C)CC[C@@]3(C)O2)C1=O |
| InChI | InChI=1S/C22H34O5/c1-13(2)7-6-9-21(3,25)15-8-10-22(4)16(15)11-14-19(24)18(26-5)12-17(23)20(14)27-22/h7,15-18,23,25H,6,8-12H2,1-5H3/t15-,16+,17+,18-,21?,22-/m1/s1 |
| InChIKey | PKJMKVUVJHKWBS-UDZHKBTQSA-N |
| XLogP | 3.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|