About [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate
[5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate (PubChem CID 72704711) has the molecular formula C11H14FNO5S
and a molecular weight of 291.30 g/mol. Its IUPAC name is [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate.
Molecular Properties
| Compound Name | [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate |
| PubChem CID | 72704711 |
| Molecular Formula | C11H14FNO5S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate |
| SMILES | CNS(=O)(=O)OC1OC(C)OC1c1ccccc1F |
| InChI | InChI=1S/C11H14FNO5S/c1-7-16-10(8-5-3-4-6-9(8)12)11(17-7)18-19(14,15)13-2/h3-7,10-11,13H,1-2H3 |
| InChIKey | KVFHTTIQDAVRBM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate?
The IUPAC name of [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate (CID 72704711) is [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate.
What is the SMILES notation for [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate?
The canonical SMILES for [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate is CNS(=O)(=O)OC1OC(C)OC1c1ccccc1F.
What is the InChIKey of [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate?
The InChIKey is KVFHTTIQDAVRBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO5S/c1-7-16-10(8-5-3-4-6-9(8)12)11(17-7)18-19(14,15)13-2/h3-7,10-11,13H,1-2H3.
What are the key properties of [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate?
[5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate has a molecular weight of 291.30 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-fluorophenyl)-2-methyl-1,3-dioxolan-4-yl] N-methylsulfamate is sourced from PubChem (CID 72704711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).