About 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine
6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 72704910) has the molecular formula C19H20FN5O
and a molecular weight of 353.40 g/mol. Its IUPAC name is 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 72704910 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2ccc(-c3cc(F)cc(CNC4CCOCC4)c3)nc12 |
| InChI | InChI=1S/C19H20FN5O/c20-14-8-12(10-22-15-3-5-26-6-4-15)7-13(9-14)16-1-2-17-18(25-16)19(21)24-11-23-17/h1-2,7-9,11,15,22H,3-6,10H2,(H2,21,23,24) |
| InChIKey | SZCVZNQHVLCQBH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine (CID 72704910) is 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine is Nc1ncnc2ccc(-c3cc(F)cc(CNC4CCOCC4)c3)nc12.
What is the InChIKey of 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is SZCVZNQHVLCQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN5O/c20-14-8-12(10-22-15-3-5-26-6-4-15)7-13(9-14)16-1-2-17-18(25-16)19(21)24-11-23-17/h1-2,7-9,11,15,22H,3-6,10H2,(H2,21,23,24).
What are the key properties of 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine?
6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 353.40 g/mol, XLogP of 2.68, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-fluoro-5-[(oxan-4-ylamino)methyl]phenyl]pyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 72704910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).