C20H30O3 — CID 72705064
(2S)-2-[(4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]propane-1,2-diol (PubChem CID 72705064) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2S)-2-[(4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]propane-1,2-diol.
| Compound Name | (2S)-2-[(4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 72705064 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2S)-2-[(4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]propane-1,2-diol |
| SMILES | C[C@]1(CO)CCC[C@]2(C)c3ccc([C@](C)(O)CO)cc3CC[C@@H]12 |
| InChI | InChI=1S/C20H30O3/c1-18(12-21)9-4-10-19(2)16-7-6-15(20(3,23)13-22)11-14(16)5-8-17(18)19/h6-7,11,17,21-23H,4-5,8-10,12-13H2,1-3H3/t17-,18+,19+,20+/m0/s1 |
| InChIKey | JGNPUBAMNFDQHS-MTQWCTHYSA-N |
| XLogP | 2.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |