C17H24N8 — CID 72705091
5,8-dimethyl-2-[2-(2-methyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 72705091) has the molecular formula C17H24N8 and a molecular weight of 340.44 g/mol. Its IUPAC name is 5,8-dimethyl-2-[2-(2-methyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 5,8-dimethyl-2-[2-(2-methyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 72705091 |
| Molecular Formula | C17H24N8 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 5,8-dimethyl-2-[2-(2-methyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ncc(C)n2nc(CCc3nc(N4CCCCC4)nn3C)nc12 |
| InChI | InChI=1S/C17H24N8/c1-12-11-18-13(2)16-19-14(21-25(12)16)7-8-15-20-17(22-23(15)3)24-9-5-4-6-10-24/h11H,4-10H2,1-3H3 |
| InChIKey | BBNSWWZHFDVDKN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |