About [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate
[2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate (PubChem CID 72705096) has the molecular formula C15H19Cl2NO5S
and a molecular weight of 396.29 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate.
Molecular Properties
| Compound Name | [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate |
| PubChem CID | 72705096 |
| Molecular Formula | C15H19Cl2NO5S |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate |
| SMILES | CNS(=O)(=O)OC1OC2(CCCCC2)OC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2NO5S/c1-18-24(19,20)23-14-13(11-6-5-10(16)9-12(11)17)21-15(22-14)7-3-2-4-8-15/h5-6,9,13-14,18H,2-4,7-8H2,1H3 |
| InChIKey | HKKBEQNHGMHVGX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate?
The IUPAC name of [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate (CID 72705096) is [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate.
What is the SMILES notation for [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate?
The canonical SMILES for [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate is CNS(=O)(=O)OC1OC2(CCCCC2)OC1c1ccc(Cl)cc1Cl.
What is the InChIKey of [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate?
The InChIKey is HKKBEQNHGMHVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2NO5S/c1-18-24(19,20)23-14-13(11-6-5-10(16)9-12(11)17)21-15(22-14)7-3-2-4-8-15/h5-6,9,13-14,18H,2-4,7-8H2,1H3.
What are the key properties of [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate?
[2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate has a molecular weight of 396.29 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dichlorophenyl)-1,4-dioxaspiro[4.5]decan-3-yl] N-methylsulfamate is sourced from PubChem (CID 72705096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).