C16H19Cl2N7 — CID 72705281
6,8-dichloro-5-methyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 72705281) has the molecular formula C16H19Cl2N7 and a molecular weight of 380.28 g/mol. Its IUPAC name is 6,8-dichloro-5-methyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6,8-dichloro-5-methyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 72705281 |
| Molecular Formula | C16H19Cl2N7 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 6,8-dichloro-5-methyl-2-[2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1c(Cl)cc(Cl)c2nc(CCc3nc(N4CCCC4)nn3C)nn12 |
| InChI | InChI=1S/C16H19Cl2N7/c1-10-11(17)9-12(18)15-19-13(21-25(10)15)5-6-14-20-16(22-23(14)2)24-7-3-4-8-24/h9H,3-8H2,1-2H3 |
| InChIKey | KKAGVWDOTJPUKI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |