C16H24N8 — CID 72705286
5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-N,N-diethyl-1-methyl-1,2,4-triazol-3-amine (PubChem CID 72705286) has the molecular formula C16H24N8 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-N,N-diethyl-1-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-N,N-diethyl-1-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 72705286 |
| Molecular Formula | C16H24N8 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-N,N-diethyl-1-methyl-1,2,4-triazol-3-amine |
| SMILES | CCN(CC)c1nc(CCc2nc3c(C)ncc(C)n3n2)n(C)n1 |
| InChI | InChI=1S/C16H24N8/c1-6-23(7-2)16-19-14(22(5)21-16)9-8-13-18-15-12(4)17-10-11(3)24(15)20-13/h10H,6-9H2,1-5H3 |
| InChIKey | FMWWPUCQVQAFAU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |