C22H29N3O2 — CID 72705389
US9000185, 4, isomer 1 (PubChem CID 72705389) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol.
| Compound Name | US9000185, 4, isomer 1 |
|---|---|
| PubChem CID | 72705389 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(OCC3CC3)cc1[C@@]21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C22H29N3O2/c1-14-20(23)25-22(24-14)19-11-18(27-13-15-3-4-15)6-5-16(19)12-21(22)9-7-17(26-2)8-10-21/h5-6,11,15,17H,3-4,7-10,12-13H2,1-2H3,(H2,23,25)/t17?,21?,22-/m0/s1 |
| InChIKey | DSCREMQTOOAGKC-IVXJCAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |