C23H25Cl2N7O — CID 72705473
6,8-dichloro-2-[2-[2-[(4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 72705473) has the molecular formula C23H25Cl2N7O and a molecular weight of 486.41 g/mol. Its IUPAC name is 6,8-dichloro-2-[2-[2-[(4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6,8-dichloro-2-[2-[2-[(4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 72705473 |
| Molecular Formula | C23H25Cl2N7O |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 6,8-dichloro-2-[2-[2-[(4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl]ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1ccc(Cn2nc(N3CCCC3)nc2CCc2nc3c(Cl)cc(Cl)c(C)n3n2)cc1 |
| InChI | InChI=1S/C23H25Cl2N7O/c1-15-18(24)13-19(25)22-26-20(28-32(15)22)9-10-21-27-23(30-11-3-4-12-30)29-31(21)14-16-5-7-17(33-2)8-6-16/h5-8,13H,3-4,9-12,14H2,1-2H3 |
| InChIKey | WXBGRWPXCUUDSN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |