C15H29FN4O2Si — CID 72705628
2-amino-3-[1-[2-[ditert-butyl(fluoro)silyl]ethyl]triazol-4-yl]propanoic acid (PubChem CID 72705628) has the molecular formula C15H29FN4O2Si and a molecular weight of 343.51 g/mol. Its IUPAC name is 2-amino-3-[1-[2-[ditert-butyl(fluoro)silyl]ethyl]triazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[1-[2-[ditert-butyl(fluoro)silyl]ethyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 72705628 |
| Molecular Formula | C15H29FN4O2Si |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-amino-3-[1-[2-[ditert-butyl(fluoro)silyl]ethyl]triazol-4-yl]propanoic acid |
| SMILES | CC(C)(C)[Si]([18F])(CCn1cc(CC(N)C(=O)O)nn1)C(C)(C)C |
| InChI | InChI=1S/C15H29FN4O2Si/c1-14(2,3)23(16,15(4,5)6)8-7-20-10-11(18-19-20)9-12(17)13(21)22/h10,12H,7-9,17H2,1-6H3,(H,21,22)/i16-1 |
| InChIKey | SAWSFRBZNMLAJW-GKTGUEEDSA-N |
| XLogP | 2.75 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|