C29H30F3N5O5 — CID 72705683
N-[6-(hydroxyamino)-6-oxohexyl]-4-[[(1S)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]carbamoylamino]benzamide (PubChem CID 72705683) has the molecular formula C29H30F3N5O5 and a molecular weight of 585.58 g/mol. Its IUPAC name is N-[6-(hydroxyamino)-6-oxohexyl]-4-[[(1S)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]carbamoylamino]benzamide.
| Compound Name | N-[6-(hydroxyamino)-6-oxohexyl]-4-[[(1S)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 72705683 |
| Molecular Formula | C29H30F3N5O5 |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | N-[6-(hydroxyamino)-6-oxohexyl]-4-[[(1S)-2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl]carbamoylamino]benzamide |
| SMILES | O=C(CCCCCNC(=O)c1ccc(NC(=O)N[C@H](C(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C29H30F3N5O5/c30-29(31,32)21-10-7-11-23(18-21)34-27(40)25(19-8-3-1-4-9-19)36-28(41)35-22-15-13-20(14-16-22)26(39)33-17-6-2-5-12-24(38)37-42/h1,3-4,7-11,13-16,18,25,42H,2,5-6,12,17H2,(H,33,39)(H,34,40)(H,37,38)(H2,35,36,41)/t25-/m0/s1 |
| InChIKey | UJIQBQIFSXGMGX-VWLOTQADSA-N |
| XLogP | 5.00 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|