C17H25NO6 — CID 72705977
ethyl 4-[[2-[(2,4-dihydroxyphenyl)methyl]-4-hydroxybutanoyl]amino]butanoate (PubChem CID 72705977) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is ethyl 4-[[2-[(2,4-dihydroxyphenyl)methyl]-4-hydroxybutanoyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[(2,4-dihydroxyphenyl)methyl]-4-hydroxybutanoyl]amino]butanoate |
|---|---|
| PubChem CID | 72705977 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | ethyl 4-[[2-[(2,4-dihydroxyphenyl)methyl]-4-hydroxybutanoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)C(CCO)Cc1ccc(O)cc1O |
| InChI | InChI=1S/C17H25NO6/c1-2-24-16(22)4-3-8-18-17(23)13(7-9-19)10-12-5-6-14(20)11-15(12)21/h5-6,11,13,19-21H,2-4,7-10H2,1H3,(H,18,23) |
| InChIKey | PBICVKHPYOWZBA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|